C27H31ClN6O3 — CID 58234541
9-[[2-chloro-5-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]methyl]-8-methoxy-2-(2-methoxyethoxy)purin-6-amine (PubChem CID 58234541) has the molecular formula C27H31ClN6O3 and a molecular weight of 523.04 g/mol. Its IUPAC name is 9-[[2-chloro-5-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]methyl]-8-methoxy-2-(2-methoxyethoxy)purin-6-amine.
| Compound Name | 9-[[2-chloro-5-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]methyl]-8-methoxy-2-(2-methoxyethoxy)purin-6-amine |
|---|---|
| PubChem CID | 58234541 |
| Molecular Formula | C27H31ClN6O3 |
| Molecular Weight | 523.04 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 9-[[2-chloro-5-[4-(pyrrolidin-1-ylmethyl)phenyl]phenyl]methyl]-8-methoxy-2-(2-methoxyethoxy)purin-6-amine |
| SMILES | COCCOc1nc(N)c2nc(OC)n(Cc3cc(-c4ccc(CN5CCCC5)cc4)ccc3Cl)c2n1 |
| InChI | InChI=1S/C27H31ClN6O3/c1-35-13-14-37-26-31-24(29)23-25(32-26)34(27(30-23)36-2)17-21-15-20(9-10-22(21)28)19-7-5-18(6-8-19)16-33-11-3-4-12-33/h5-10,15H,3-4,11-14,16-17H2,1-2H3,(H2,29,31,32) |
| InChIKey | ORODTCSLSABGAP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.04 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|