C27H33N7O2 — CID 58234533
2-butoxy-8-methoxy-9-[[5-[3-(pyrrolidin-1-ylmethyl)phenyl]-2-pyridinyl]methyl]purin-6-amine (PubChem CID 58234533) has the molecular formula C27H33N7O2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-butoxy-8-methoxy-9-[[5-[3-(pyrrolidin-1-ylmethyl)phenyl]-2-pyridinyl]methyl]purin-6-amine.
| Compound Name | 2-butoxy-8-methoxy-9-[[5-[3-(pyrrolidin-1-ylmethyl)phenyl]-2-pyridinyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 58234533 |
| Molecular Formula | C27H33N7O2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 2-butoxy-8-methoxy-9-[[5-[3-(pyrrolidin-1-ylmethyl)phenyl]-2-pyridinyl]methyl]purin-6-amine |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(Cc3ccc(-c4cccc(CN5CCCC5)c4)cn3)c2n1 |
| InChI | InChI=1S/C27H33N7O2/c1-3-4-14-36-26-31-24(28)23-25(32-26)34(27(30-23)35-2)18-22-11-10-21(16-29-22)20-9-7-8-19(15-20)17-33-12-5-6-13-33/h7-11,15-16H,3-6,12-14,17-18H2,1-2H3,(H2,28,31,32) |
| InChIKey | JJWMPQKTKUEMDF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|