C20H27N5O4 — CID 170741806
2-[4-[(6-amino-2-butoxy-8-methoxypurin-9-yl)methyl]-3-methoxyphenyl]ethanol (PubChem CID 170741806) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-[4-[(6-amino-2-butoxy-8-methoxypurin-9-yl)methyl]-3-methoxyphenyl]ethanol.
| Compound Name | 2-[4-[(6-amino-2-butoxy-8-methoxypurin-9-yl)methyl]-3-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 170741806 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 2-[4-[(6-amino-2-butoxy-8-methoxypurin-9-yl)methyl]-3-methoxyphenyl]ethanol |
| SMILES | CCCCOc1nc(N)c2nc(OC)n(Cc3ccc(CCO)cc3OC)c2n1 |
| InChI | InChI=1S/C20H27N5O4/c1-4-5-10-29-19-23-17(21)16-18(24-19)25(20(22-16)28-3)12-14-7-6-13(8-9-26)11-15(14)27-2/h6-7,11,26H,4-5,8-10,12H2,1-3H3,(H2,21,23,24) |
| InChIKey | VZKYLAUMBGWTQJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|