C26H28F3N7O2 — CID 138700936
9-[[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]methyl]-8-(5-fluoro-3-pyridinyl)-2-(2-methoxyethoxy)purin-6-amine (PubChem CID 138700936) has the molecular formula C26H28F3N7O2 and a molecular weight of 527.55 g/mol. Its IUPAC name is 9-[[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]methyl]-8-(5-fluoro-3-pyridinyl)-2-(2-methoxyethoxy)purin-6-amine.
| Compound Name | 9-[[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]methyl]-8-(5-fluoro-3-pyridinyl)-2-(2-methoxyethoxy)purin-6-amine |
|---|---|
| PubChem CID | 138700936 |
| Molecular Formula | C26H28F3N7O2 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 9-[[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]methyl]-8-(5-fluoro-3-pyridinyl)-2-(2-methoxyethoxy)purin-6-amine |
| SMILES | COCCOc1nc(N)c2nc(-c3cncc(F)c3)n(Cc3ccc(CN4CCC(F)(F)CC4)cc3)c2n1 |
| InChI | InChI=1S/C26H28F3N7O2/c1-37-10-11-38-25-33-22(30)21-24(34-25)36(23(32-21)19-12-20(27)14-31-13-19)16-18-4-2-17(3-5-18)15-35-8-6-26(28,29)7-9-35/h2-5,12-14H,6-11,15-16H2,1H3,(H2,30,33,34) |
| InChIKey | LBJRLFGZKDQRCH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|