C17H14FN7O3 — CID 138701020
5-[[6-amino-2-ethoxy-8-(5-fluoro-3-pyridinyl)purin-9-yl]methyl]-1,2-oxazole-3-carbaldehyde (PubChem CID 138701020) has the molecular formula C17H14FN7O3 and a molecular weight of 383.34 g/mol. Its IUPAC name is 5-[[6-amino-2-ethoxy-8-(5-fluoro-3-pyridinyl)purin-9-yl]methyl]-1,2-oxazole-3-carbaldehyde.
| Compound Name | 5-[[6-amino-2-ethoxy-8-(5-fluoro-3-pyridinyl)purin-9-yl]methyl]-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 138701020 |
| Molecular Formula | C17H14FN7O3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-[[6-amino-2-ethoxy-8-(5-fluoro-3-pyridinyl)purin-9-yl]methyl]-1,2-oxazole-3-carbaldehyde |
| SMILES | CCOc1nc(N)c2nc(-c3cncc(F)c3)n(Cc3cc(C=O)no3)c2n1 |
| InChI | InChI=1S/C17H14FN7O3/c1-2-27-17-22-14(19)13-16(23-17)25(7-12-4-11(8-26)24-28-12)15(21-13)9-3-10(18)6-20-5-9/h3-6,8H,2,7H2,1H3,(H2,19,22,23) |
| InChIKey | DLVHUKRURNESMR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|