C22H23FN6O4 — CID 166713755
[4-[[6-amino-8-(5-fluoro-3-pyridinyl)-2-(2-methoxyethoxy)purin-9-yl]methyl]phenyl]-methoxymethanol (PubChem CID 166713755) has the molecular formula C22H23FN6O4 and a molecular weight of 454.46 g/mol. Its IUPAC name is [4-[[6-amino-8-(5-fluoro-3-pyridinyl)-2-(2-methoxyethoxy)purin-9-yl]methyl]phenyl]-methoxymethanol.
| Compound Name | [4-[[6-amino-8-(5-fluoro-3-pyridinyl)-2-(2-methoxyethoxy)purin-9-yl]methyl]phenyl]-methoxymethanol |
|---|---|
| PubChem CID | 166713755 |
| Molecular Formula | C22H23FN6O4 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | [4-[[6-amino-8-(5-fluoro-3-pyridinyl)-2-(2-methoxyethoxy)purin-9-yl]methyl]phenyl]-methoxymethanol |
| SMILES | COCCOc1nc(N)c2nc(-c3cncc(F)c3)n(Cc3ccc(C(O)OC)cc3)c2n1 |
| InChI | InChI=1S/C22H23FN6O4/c1-31-7-8-33-22-27-18(24)17-20(28-22)29(19(26-17)15-9-16(23)11-25-10-15)12-13-3-5-14(6-4-13)21(30)32-2/h3-6,9-11,21,30H,7-8,12H2,1-2H3,(H2,24,27,28) |
| InChIKey | FHQGPMYKAOWMGB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 130.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|