C23H23FN6O — CID 138700938
8-(5-fluoro-3-pyridinyl)-2-methoxy-6-methyl-9-[(4-pyrrolidin-3-ylphenyl)methyl]purine (PubChem CID 138700938) has the molecular formula C23H23FN6O and a molecular weight of 418.48 g/mol. Its IUPAC name is 8-(5-fluoro-3-pyridinyl)-2-methoxy-6-methyl-9-[(4-pyrrolidin-3-ylphenyl)methyl]purine.
| Compound Name | 8-(5-fluoro-3-pyridinyl)-2-methoxy-6-methyl-9-[(4-pyrrolidin-3-ylphenyl)methyl]purine |
|---|---|
| PubChem CID | 138700938 |
| Molecular Formula | C23H23FN6O |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 8-(5-fluoro-3-pyridinyl)-2-methoxy-6-methyl-9-[(4-pyrrolidin-3-ylphenyl)methyl]purine |
| SMILES | COc1nc(C)c2nc(-c3cncc(F)c3)n(Cc3ccc(C4CCNC4)cc3)c2n1 |
| InChI | InChI=1S/C23H23FN6O/c1-14-20-22(29-23(27-14)31-2)30(21(28-20)18-9-19(24)12-26-11-18)13-15-3-5-16(6-4-15)17-7-8-25-10-17/h3-6,9,11-12,17,25H,7-8,10,13H2,1-2H3 |
| InChIKey | NTXWWAYJPSKOPW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |