C18H14F2N6 — CID 161093671
9-[(2-fluorophenyl)methyl]-8-(5-fluoro-3-pyridinyl)-2-methylpurin-6-amine (PubChem CID 161093671) has the molecular formula C18H14F2N6 and a molecular weight of 352.35 g/mol. Its IUPAC name is 9-[(2-fluorophenyl)methyl]-8-(5-fluoro-3-pyridinyl)-2-methylpurin-6-amine.
| Compound Name | 9-[(2-fluorophenyl)methyl]-8-(5-fluoro-3-pyridinyl)-2-methylpurin-6-amine |
|---|---|
| PubChem CID | 161093671 |
| Molecular Formula | C18H14F2N6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 9-[(2-fluorophenyl)methyl]-8-(5-fluoro-3-pyridinyl)-2-methylpurin-6-amine |
| SMILES | Cc1nc(N)c2nc(-c3cncc(F)c3)n(Cc3ccccc3F)c2n1 |
| InChI | InChI=1S/C18H14F2N6/c1-10-23-16(21)15-18(24-10)26(9-11-4-2-3-5-14(11)20)17(25-15)12-6-13(19)8-22-7-12/h2-8H,9H2,1H3,(H2,21,23,24) |
| InChIKey | UHMUFYSOVSQKEF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |