C18H15ClFN7 — CID 145389859
9-[(6-chloro-2-pyridinyl)methyl]-2-ethyl-8-(5-fluoro-3-pyridinyl)purin-6-amine (PubChem CID 145389859) has the molecular formula C18H15ClFN7 and a molecular weight of 383.82 g/mol. Its IUPAC name is 9-[(6-chloro-2-pyridinyl)methyl]-2-ethyl-8-(5-fluoro-3-pyridinyl)purin-6-amine.
| Compound Name | 9-[(6-chloro-2-pyridinyl)methyl]-2-ethyl-8-(5-fluoro-3-pyridinyl)purin-6-amine |
|---|---|
| PubChem CID | 145389859 |
| Molecular Formula | C18H15ClFN7 |
| Molecular Weight | 383.82 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 9-[(6-chloro-2-pyridinyl)methyl]-2-ethyl-8-(5-fluoro-3-pyridinyl)purin-6-amine |
| SMILES | CCc1nc(N)c2nc(-c3cncc(F)c3)n(Cc3cccc(Cl)n3)c2n1 |
| InChI | InChI=1S/C18H15ClFN7/c1-2-14-24-16(21)15-18(25-14)27(9-12-4-3-5-13(19)23-12)17(26-15)10-6-11(20)8-22-7-10/h3-8H,2,9H2,1H3,(H2,21,24,25) |
| InChIKey | JHSBWSUQAFTXKR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.82 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|