C18H23ClFN5O — CID 22133788
4-[6-amino-9-ethyl-8-(3-fluorophenyl)purin-2-yl]-2-methylbutan-2-ol;hydrochloride (PubChem CID 22133788) has the molecular formula C18H23ClFN5O and a molecular weight of 379.87 g/mol. Its IUPAC name is 4-[6-amino-9-ethyl-8-(3-fluorophenyl)purin-2-yl]-2-methylbutan-2-ol;hydrochloride.
| Compound Name | 4-[6-amino-9-ethyl-8-(3-fluorophenyl)purin-2-yl]-2-methylbutan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 22133788 |
| Molecular Formula | C18H23ClFN5O |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[6-amino-9-ethyl-8-(3-fluorophenyl)purin-2-yl]-2-methylbutan-2-ol;hydrochloride |
| SMILES | CCn1c(-c2cccc(F)c2)nc2c(N)nc(CCC(C)(C)O)nc21.Cl |
| InChI | InChI=1S/C18H22FN5O.ClH/c1-4-24-16(11-6-5-7-12(19)10-11)23-14-15(20)21-13(22-17(14)24)8-9-18(2,3)25;/h5-7,10,25H,4,8-9H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | NYISGAWTNDLBOL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |