C49H68N14O7 — CID 141229366
bis[2-[6-amino-2-(2-methoxyethoxy)-9-[[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]purin-8-yl]propan-2-yl] carbonate (PubChem CID 141229366) has the molecular formula C49H68N14O7 and a molecular weight of 965.17 g/mol. Its IUPAC name is bis[2-[6-amino-2-(2-methoxyethoxy)-9-[[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]purin-8-yl]propan-2-yl] carbonate.
| Compound Name | bis[2-[6-amino-2-(2-methoxyethoxy)-9-[[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]purin-8-yl]propan-2-yl] carbonate |
|---|---|
| PubChem CID | 141229366 |
| Molecular Formula | C49H68N14O7 |
| Molecular Weight | 965.17 g/mol |
| Exact Mass | 964.54 |
| IUPAC Name | bis[2-[6-amino-2-(2-methoxyethoxy)-9-[[3-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]purin-8-yl]propan-2-yl] carbonate |
| SMILES | COCCOc1nc(N)c2nc(C(C)(C)OC(=O)OC(C)(C)c3nc4c(N)nc(OCCOC)nc4n3Cc3cccc(CN4CCN(C)CC4)c3)n(Cc3cccc(CN4CCN(C)CC4)c3)c2n1 |
| InChI | InChI=1S/C49H68N14O7/c1-48(2,43-52-37-39(50)54-45(67-25-23-65-7)56-41(37)62(43)31-35-13-9-11-33(27-35)29-60-19-15-58(5)16-20-60)69-47(64)70-49(3,4)44-53-38-40(51)55-46(68-26-24-66-8)57-42(38)63(44)32-36-14-10-12-34(28-36)30-61-21-17-59(6)18-22-61/h9-14,27-28H,15-26,29-32H2,1-8H3,(H2,50,54,56)(H2,51,55,57) |
| InChIKey | PKDZHKPNLYIDHB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 224.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|