C21H21N5O2 — CID 18440494
8-(furan-2-yl)-2-(3-phenylpropoxy)-9-prop-2-enylpurin-6-amine (PubChem CID 18440494) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 8-(furan-2-yl)-2-(3-phenylpropoxy)-9-prop-2-enylpurin-6-amine.
| Compound Name | 8-(furan-2-yl)-2-(3-phenylpropoxy)-9-prop-2-enylpurin-6-amine |
|---|---|
| PubChem CID | 18440494 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 8-(furan-2-yl)-2-(3-phenylpropoxy)-9-prop-2-enylpurin-6-amine |
| SMILES | C=CCn1c(-c2ccco2)nc2c(N)nc(OCCCc3ccccc3)nc21 |
| InChI | InChI=1S/C21H21N5O2/c1-2-12-26-19(16-11-7-13-27-16)23-17-18(22)24-21(25-20(17)26)28-14-6-10-15-8-4-3-5-9-15/h2-5,7-9,11,13H,1,6,10,12,14H2,(H2,22,24,25) |
| InChIKey | BZJSRVXMGOQYKC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|