C13H14FN3O — CID 59160610
5-fluoro-2-(3-phenylpropoxy)pyrimidin-4-amine (PubChem CID 59160610) has the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. Its IUPAC name is 5-fluoro-2-(3-phenylpropoxy)pyrimidin-4-amine.
| Compound Name | 5-fluoro-2-(3-phenylpropoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 59160610 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5-fluoro-2-(3-phenylpropoxy)pyrimidin-4-amine |
| SMILES | Nc1nc(OCCCc2ccccc2)ncc1F |
| InChI | InChI=1S/C13H14FN3O/c14-11-9-16-13(17-12(11)15)18-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H2,15,16,17) |
| InChIKey | NSMQRJQHPGDEDG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|