C12H13FN4 — CID 83712714
5-fluoro-2-N-(2-phenylethyl)pyrimidine-2,4-diamine (PubChem CID 83712714) has the molecular formula C12H13FN4 and a molecular weight of 232.26 g/mol. Its IUPAC name is 5-fluoro-2-N-(2-phenylethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-(2-phenylethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 83712714 |
| Molecular Formula | C12H13FN4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 5-fluoro-2-N-(2-phenylethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCCc2ccccc2)ncc1F |
| InChI | InChI=1S/C12H13FN4/c13-10-8-16-12(17-11(10)14)15-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H3,14,15,16,17) |
| InChIKey | AGGOYZQDHCUCMQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |