C13H11ClN3O2- — CID 2325047
5-chloro-2-(2-phenylethylamino)pyrimidine-4-carboxylate (PubChem CID 2325047) has the molecular formula C13H11ClN3O2- and a molecular weight of 276.70 g/mol. Its IUPAC name is 5-chloro-2-(2-phenylethylamino)pyrimidine-4-carboxylate.
| Compound Name | 5-chloro-2-(2-phenylethylamino)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 2325047 |
| Molecular Formula | C13H11ClN3O2- |
| Molecular Weight | 276.70 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 5-chloro-2-(2-phenylethylamino)pyrimidine-4-carboxylate |
| SMILES | O=C([O-])c1nc(NCCc2ccccc2)ncc1Cl |
| InChI | InChI=1S/C13H12ClN3O2/c14-10-8-16-13(17-11(10)12(18)19)15-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,18,19)(H,15,16,17)/p-1 |
| InChIKey | IENXQMOXRHNNNW-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 77.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.70 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |