C13H14ClN3 — CID 79557504
5-chloro-N-(3-phenylpropyl)pyrimidin-2-amine (PubChem CID 79557504) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is 5-chloro-N-(3-phenylpropyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-(3-phenylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 79557504 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 5-chloro-N-(3-phenylpropyl)pyrimidin-2-amine |
| SMILES | Clc1cnc(NCCCc2ccccc2)nc1 |
| InChI | InChI=1S/C13H14ClN3/c14-12-9-16-13(17-10-12)15-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H,15,16,17) |
| InChIKey | XXWXRJJWYBQEHF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|