C19H21N5 — CID 140545114
5-(4-methylphenyl)-2-N-(2-phenylethyl)pyrimidine-2,4,6-triamine (PubChem CID 140545114) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2-N-(2-phenylethyl)pyrimidine-2,4,6-triamine.
| Compound Name | 5-(4-methylphenyl)-2-N-(2-phenylethyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 140545114 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 5-(4-methylphenyl)-2-N-(2-phenylethyl)pyrimidine-2,4,6-triamine |
| SMILES | Cc1ccc(-c2c(N)nc(NCCc3ccccc3)nc2N)cc1 |
| InChI | InChI=1S/C19H21N5/c1-13-7-9-15(10-8-13)16-17(20)23-19(24-18(16)21)22-12-11-14-5-3-2-4-6-14/h2-10H,11-12H2,1H3,(H5,20,21,22,23,24) |
| InChIKey | PASIDOGILSEOBT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |