C12H17N7 — CID 139976102
4,6-dihydrazinyl-N-(2-phenylethyl)pyrimidin-2-amine (PubChem CID 139976102) has the molecular formula C12H17N7 and a molecular weight of 259.32 g/mol. Its IUPAC name is 4,6-dihydrazinyl-N-(2-phenylethyl)pyrimidin-2-amine.
| Compound Name | 4,6-dihydrazinyl-N-(2-phenylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 139976102 |
| Molecular Formula | C12H17N7 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 4,6-dihydrazinyl-N-(2-phenylethyl)pyrimidin-2-amine |
| SMILES | NNc1cc(NN)nc(NCCc2ccccc2)n1 |
| InChI | InChI=1S/C12H17N7/c13-18-10-8-11(19-14)17-12(16-10)15-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7,13-14H2,(H3,15,16,17,18,19) |
| InChIKey | XMDXCWBZABJJAD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|