C13H17N5O — CID 80778104
6-ethoxy-2-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80778104) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-ethoxy-2-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-ethoxy-2-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80778104 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 6-ethoxy-2-N-(2-phenylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCOc1nc(N)nc(NCCc2ccccc2)n1 |
| InChI | InChI=1S/C13H17N5O/c1-2-19-13-17-11(14)16-12(18-13)15-9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H3,14,15,16,17,18) |
| InChIKey | GEYCVCOFFJUPOK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |