C13H15N6+ — CID 123419618
2-N-(2-phenylethyl)-7H-purin-9-ium-2,6-diamine (PubChem CID 123419618) has the molecular formula C13H15N6+ and a molecular weight of 255.31 g/mol. Its IUPAC name is 2-N-(2-phenylethyl)-7H-purin-9-ium-2,6-diamine.
| Compound Name | 2-N-(2-phenylethyl)-7H-purin-9-ium-2,6-diamine |
|---|---|
| PubChem CID | 123419618 |
| Molecular Formula | C13H15N6+ |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-N-(2-phenylethyl)-7H-purin-9-ium-2,6-diamine |
| SMILES | Nc1nc(NCCc2ccccc2)nc2[nH+]c[nH]c12 |
| InChI | InChI=1S/C13H14N6/c14-11-10-12(17-8-16-10)19-13(18-11)15-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H4,14,15,16,17,18,19)/p+1 |
| InChIKey | ILQVLBMOQOCNKB-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |