C13H13ClN5+ — CID 123728415
2-chloro-N-(2-phenylethyl)-7H-purin-9-ium-6-amine (PubChem CID 123728415) has the molecular formula C13H13ClN5+ and a molecular weight of 274.74 g/mol. Its IUPAC name is 2-chloro-N-(2-phenylethyl)-7H-purin-9-ium-6-amine.
| Compound Name | 2-chloro-N-(2-phenylethyl)-7H-purin-9-ium-6-amine |
|---|---|
| PubChem CID | 123728415 |
| Molecular Formula | C13H13ClN5+ |
| Molecular Weight | 274.74 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-chloro-N-(2-phenylethyl)-7H-purin-9-ium-6-amine |
| SMILES | Clc1nc(NCCc2ccccc2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C13H12ClN5/c14-13-18-11(10-12(19-13)17-8-16-10)15-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,15,16,17,18,19)/p+1 |
| InChIKey | SBBAPHCUEHMAKN-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |