C20H18N5O2+ — CID 123354551
6-(2,2-diphenylethylamino)-7H-purin-9-ium-2-carboxylic acid (PubChem CID 123354551) has the molecular formula C20H18N5O2+ and a molecular weight of 360.40 g/mol. Its IUPAC name is 6-(2,2-diphenylethylamino)-7H-purin-9-ium-2-carboxylic acid.
| Compound Name | 6-(2,2-diphenylethylamino)-7H-purin-9-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 123354551 |
| Molecular Formula | C20H18N5O2+ |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 6-(2,2-diphenylethylamino)-7H-purin-9-ium-2-carboxylic acid |
| SMILES | O=C(O)c1nc(NCC(c2ccccc2)c2ccccc2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C20H17N5O2/c26-20(27)19-24-17(16-18(25-19)23-12-22-16)21-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,12,15H,11H2,(H,26,27)(H2,21,22,23,24,25)/p+1 |
| InChIKey | PNWLSMXJLMTMQJ-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |