C13H11ClN5O2+ — CID 123835648
N-(2-chloro-7H-purin-9-ium-6-yl)-2-phenoxyacetamide (PubChem CID 123835648) has the molecular formula C13H11ClN5O2+ and a molecular weight of 304.72 g/mol. Its IUPAC name is N-(2-chloro-7H-purin-9-ium-6-yl)-2-phenoxyacetamide.
| Compound Name | N-(2-chloro-7H-purin-9-ium-6-yl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 123835648 |
| Molecular Formula | C13H11ClN5O2+ |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-(2-chloro-7H-purin-9-ium-6-yl)-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1nc(Cl)nc2[nH+]c[nH]c12 |
| InChI | InChI=1S/C13H10ClN5O2/c14-13-18-11-10(15-7-16-11)12(19-13)17-9(20)6-21-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,15,16,17,18,19,20)/p+1 |
| InChIKey | ZDYJPTSUCACZGE-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |