C11H12N4O3 — CID 83093509
N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-phenoxyacetamide (PubChem CID 83093509) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-phenoxyacetamide.
| Compound Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 83093509 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-phenoxyacetamide |
| SMILES | COc1n[nH]c(NC(=O)COc2ccccc2)n1 |
| InChI | InChI=1S/C11H12N4O3/c1-17-11-13-10(14-15-11)12-9(16)7-18-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | QPGPYLYGAWHDQC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |