C11H11N5O5 — CID 83090279
N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-(3-nitrophenoxy)acetamide (PubChem CID 83090279) has the molecular formula C11H11N5O5 and a molecular weight of 293.24 g/mol. Its IUPAC name is N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-(3-nitrophenoxy)acetamide.
| Compound Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-(3-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 83090279 |
| Molecular Formula | C11H11N5O5 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(3-methoxy-1H-1,2,4-triazol-5-yl)-2-(3-nitrophenoxy)acetamide |
| SMILES | COc1n[nH]c(NC(=O)COc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H11N5O5/c1-20-11-13-10(14-15-11)12-9(17)6-21-8-4-2-3-7(5-8)16(18)19/h2-5H,6H2,1H3,(H2,12,13,14,15,17) |
| InChIKey | CUGWOPWQKYNLMX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|