C13H13FN6 — CID 121390717
2-N-[2-(4-fluorophenyl)ethyl]-7H-purine-2,6-diamine (PubChem CID 121390717) has the molecular formula C13H13FN6 and a molecular weight of 272.29 g/mol. Its IUPAC name is 2-N-[2-(4-fluorophenyl)ethyl]-7H-purine-2,6-diamine.
| Compound Name | 2-N-[2-(4-fluorophenyl)ethyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 121390717 |
| Molecular Formula | C13H13FN6 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-N-[2-(4-fluorophenyl)ethyl]-7H-purine-2,6-diamine |
| SMILES | Nc1nc(NCCc2ccc(F)cc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H13FN6/c14-9-3-1-8(2-4-9)5-6-16-13-19-11(15)10-12(20-13)18-7-17-10/h1-4,7H,5-6H2,(H4,15,16,17,18,19,20) |
| InChIKey | IVWFQIMPJXSMJT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |