C19H19N7O — CID 117082288
4-[2-[[2-(pyridin-3-ylmethylamino)-7H-purin-6-yl]amino]ethyl]phenol (PubChem CID 117082288) has the molecular formula C19H19N7O and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-[2-[[2-(pyridin-3-ylmethylamino)-7H-purin-6-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(pyridin-3-ylmethylamino)-7H-purin-6-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117082288 |
| Molecular Formula | C19H19N7O |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-[2-[[2-(pyridin-3-ylmethylamino)-7H-purin-6-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2nc(NCc3cccnc3)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C19H19N7O/c27-15-5-3-13(4-6-15)7-9-21-17-16-18(24-12-23-16)26-19(25-17)22-11-14-2-1-8-20-10-14/h1-6,8,10,12,27H,7,9,11H2,(H3,21,22,23,24,25,26) |
| InChIKey | GHFALLKHHPJNRI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |