C13H14FN3 — CID 55152107
N-[2-(4-fluorophenyl)ethyl]-4-methylpyrimidin-2-amine (PubChem CID 55152107) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-4-methylpyrimidin-2-amine.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 55152107 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-4-methylpyrimidin-2-amine |
| SMILES | Cc1ccnc(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C13H14FN3/c1-10-6-8-15-13(17-10)16-9-7-11-2-4-12(14)5-3-11/h2-6,8H,7,9H2,1H3,(H,15,16,17) |
| InChIKey | CMKDTLDLISXHJA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |