C10H12N8 — CID 167947742
2-N-[(1-methylpyrazol-3-yl)methyl]-7H-purine-2,6-diamine (PubChem CID 167947742) has the molecular formula C10H12N8 and a molecular weight of 244.26 g/mol. Its IUPAC name is 2-N-[(1-methylpyrazol-3-yl)methyl]-7H-purine-2,6-diamine.
| Compound Name | 2-N-[(1-methylpyrazol-3-yl)methyl]-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 167947742 |
| Molecular Formula | C10H12N8 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-N-[(1-methylpyrazol-3-yl)methyl]-7H-purine-2,6-diamine |
| SMILES | Cn1ccc(CNc2nc(N)c3[nH]cnc3n2)n1 |
| InChI | InChI=1S/C10H12N8/c1-18-3-2-6(17-18)4-12-10-15-8(11)7-9(16-10)14-5-13-7/h2-3,5H,4H2,1H3,(H4,11,12,13,14,15,16) |
| InChIKey | DRZWKKPALDVDGN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |