C12H12N4S — CID 103818834
N-[(1-methylpyrazol-3-yl)methyl]-1,3-benzothiazol-6-amine (PubChem CID 103818834) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is N-[(1-methylpyrazol-3-yl)methyl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[(1-methylpyrazol-3-yl)methyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 103818834 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-[(1-methylpyrazol-3-yl)methyl]-1,3-benzothiazol-6-amine |
| SMILES | Cn1ccc(CNc2ccc3ncsc3c2)n1 |
| InChI | InChI=1S/C12H12N4S/c1-16-5-4-10(15-16)7-13-9-2-3-11-12(6-9)17-8-14-11/h2-6,8,13H,7H2,1H3 |
| InChIKey | FNUYPLHBKDUHLM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |