C16H18N4S — CID 103773135
N-[(1-cyclopentylpyrazol-3-yl)methyl]-1,3-benzothiazol-6-amine (PubChem CID 103773135) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 103773135 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-1,3-benzothiazol-6-amine |
| SMILES | c1nc2ccc(NCc3ccn(C4CCCC4)n3)cc2s1 |
| InChI | InChI=1S/C16H18N4S/c1-2-4-14(3-1)20-8-7-13(19-20)10-17-12-5-6-15-16(9-12)21-11-18-15/h5-9,11,14,17H,1-4,10H2 |
| InChIKey | UYVQDEYMPSYFKV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |