C15H16Br3N3 — CID 64800838
2,4,6-tribromo-N-[(1-cyclopentylpyrazol-3-yl)methyl]aniline (PubChem CID 64800838) has the molecular formula C15H16Br3N3 and a molecular weight of 478.03 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[(1-cyclopentylpyrazol-3-yl)methyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[(1-cyclopentylpyrazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 64800838 |
| Molecular Formula | C15H16Br3N3 |
| Molecular Weight | 478.03 g/mol |
| Exact Mass | 474.89 |
| IUPAC Name | 2,4,6-tribromo-N-[(1-cyclopentylpyrazol-3-yl)methyl]aniline |
| SMILES | Brc1cc(Br)c(NCc2ccn(C3CCCC3)n2)c(Br)c1 |
| InChI | InChI=1S/C15H16Br3N3/c16-10-7-13(17)15(14(18)8-10)19-9-11-5-6-21(20-11)12-3-1-2-4-12/h5-8,12,19H,1-4,9H2 |
| InChIKey | XVJGNPOJLBCOSU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.03 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |