C16H19Br2N3 — CID 64801058
2,4-dibromo-N-[(1-cyclohexylpyrazol-3-yl)methyl]aniline (PubChem CID 64801058) has the molecular formula C16H19Br2N3 and a molecular weight of 413.16 g/mol. Its IUPAC name is 2,4-dibromo-N-[(1-cyclohexylpyrazol-3-yl)methyl]aniline.
| Compound Name | 2,4-dibromo-N-[(1-cyclohexylpyrazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 64801058 |
| Molecular Formula | C16H19Br2N3 |
| Molecular Weight | 413.16 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2,4-dibromo-N-[(1-cyclohexylpyrazol-3-yl)methyl]aniline |
| SMILES | Brc1ccc(NCc2ccn(C3CCCCC3)n2)c(Br)c1 |
| InChI | InChI=1S/C16H19Br2N3/c17-12-6-7-16(15(18)10-12)19-11-13-8-9-21(20-13)14-4-2-1-3-5-14/h6-10,14,19H,1-5,11H2 |
| InChIKey | XSXWEJRWTRLTRO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.16 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |