C13H14N4S — CID 103756695
N-[(1-ethylimidazol-2-yl)methyl]-1,3-benzothiazol-6-amine (PubChem CID 103756695) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)methyl]-1,3-benzothiazol-6-amine.
| Compound Name | N-[(1-ethylimidazol-2-yl)methyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 103756695 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)methyl]-1,3-benzothiazol-6-amine |
| SMILES | CCn1ccnc1CNc1ccc2ncsc2c1 |
| InChI | InChI=1S/C13H14N4S/c1-2-17-6-5-14-13(17)8-15-10-3-4-11-12(7-10)18-9-16-11/h3-7,9,15H,2,8H2,1H3 |
| InChIKey | SBONIDKSTLKSFX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |