C13H15N3O2 — CID 62356540
N-[(1-ethylimidazol-2-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 62356540) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(1-ethylimidazol-2-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 62356540 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | CCn1ccnc1CNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H15N3O2/c1-2-16-6-5-14-13(16)8-15-10-3-4-11-12(7-10)18-9-17-11/h3-7,15H,2,8-9H2,1H3 |
| InChIKey | AGSZVDKPBNIQPF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|