C13H13F2N3O2 — CID 43111971
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43111971) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43111971 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | FC(F)n1ccnc1CNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H13F2N3O2/c14-13(15)18-4-3-16-12(18)8-17-9-1-2-10-11(7-9)20-6-5-19-10/h1-4,7,13,17H,5-6,8H2 |
| InChIKey | UIPGGSBIBVBTNA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|