C12H11FN5+ — CID 123941922
N-benzyl-2-fluoro-7H-purin-9-ium-6-amine (PubChem CID 123941922) has the molecular formula C12H11FN5+ and a molecular weight of 244.25 g/mol. Its IUPAC name is N-benzyl-2-fluoro-7H-purin-9-ium-6-amine.
| Compound Name | N-benzyl-2-fluoro-7H-purin-9-ium-6-amine |
|---|---|
| PubChem CID | 123941922 |
| Molecular Formula | C12H11FN5+ |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-benzyl-2-fluoro-7H-purin-9-ium-6-amine |
| SMILES | Fc1nc(NCc2ccccc2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C12H10FN5/c13-12-17-10(9-11(18-12)16-7-15-9)14-6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,14,15,16,17,18)/p+1 |
| InChIKey | TTYFSTRCKXBULP-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |