C17H14FN5 — CID 158581422
N-benzyl-9-cyclopenta-1,4-dien-1-yl-2-fluoropurin-6-amine (PubChem CID 158581422) has the molecular formula C17H14FN5 and a molecular weight of 307.33 g/mol. Its IUPAC name is N-benzyl-9-cyclopenta-1,4-dien-1-yl-2-fluoropurin-6-amine.
| Compound Name | N-benzyl-9-cyclopenta-1,4-dien-1-yl-2-fluoropurin-6-amine |
|---|---|
| PubChem CID | 158581422 |
| Molecular Formula | C17H14FN5 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-benzyl-9-cyclopenta-1,4-dien-1-yl-2-fluoropurin-6-amine |
| SMILES | Fc1nc(NCc2ccccc2)c2ncn(C3=CCC=C3)c2n1 |
| InChI | InChI=1S/C17H14FN5/c18-17-21-15(19-10-12-6-2-1-3-7-12)14-16(22-17)23(11-20-14)13-8-4-5-9-13/h1-4,6-9,11H,5,10H2,(H,19,21,22) |
| InChIKey | XEMYGCFXANMJNV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |