C19H18FN6O2S2- — CID 170538138
6-(benzylamino)-2-fluoro-9-[3-[5-(sulfinatoamino)thiophen-3-yl]propyl]purine (PubChem CID 170538138) has the molecular formula C19H18FN6O2S2- and a molecular weight of 445.53 g/mol. Its IUPAC name is 6-(benzylamino)-2-fluoro-9-[3-[5-(sulfinatoamino)thiophen-3-yl]propyl]purine.
| Compound Name | 6-(benzylamino)-2-fluoro-9-[3-[5-(sulfinatoamino)thiophen-3-yl]propyl]purine |
|---|---|
| PubChem CID | 170538138 |
| Molecular Formula | C19H18FN6O2S2- |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 6-(benzylamino)-2-fluoro-9-[3-[5-(sulfinatoamino)thiophen-3-yl]propyl]purine |
| SMILES | O=S([O-])Nc1cc(CCCn2cnc3c(NCc4ccccc4)nc(F)nc32)cs1 |
| InChI | InChI=1S/C19H19FN6O2S2/c20-19-23-17(21-10-13-5-2-1-3-6-13)16-18(24-19)26(12-22-16)8-4-7-14-9-15(29-11-14)25-30(27)28/h1-3,5-6,9,11-12,25H,4,7-8,10H2,(H,27,28)(H,21,23,24)/p-1 |
| InChIKey | IGILBEKXFJALJS-UHFFFAOYSA-M |
| XLogP | 3.48 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|