C22H22N6OS — CID 117089731
1-[2-[6-(benzylamino)-2-thiophen-2-ylpurin-9-yl]ethyl]pyrrolidin-2-one (PubChem CID 117089731) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-[2-[6-(benzylamino)-2-thiophen-2-ylpurin-9-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[6-(benzylamino)-2-thiophen-2-ylpurin-9-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 117089731 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[2-[6-(benzylamino)-2-thiophen-2-ylpurin-9-yl]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCn1cnc2c(NCc3ccccc3)nc(-c3cccs3)nc21 |
| InChI | InChI=1S/C22H22N6OS/c29-18-9-4-10-27(18)11-12-28-15-24-19-21(23-14-16-6-2-1-3-7-16)25-20(26-22(19)28)17-8-5-13-30-17/h1-3,5-8,13,15H,4,9-12,14H2,(H,23,25,26) |
| InChIKey | CDXKFBAZVPRRDS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |