C14H15N7 — CID 80772450
2-N-(2-phenylethyl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80772450) has the molecular formula C14H15N7 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-N-(2-phenylethyl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-phenylethyl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80772450 |
| Molecular Formula | C14H15N7 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-N-(2-phenylethyl)-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCCc2ccccc2)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C14H15N7/c15-12-18-13(16-9-7-11-5-2-1-3-6-11)20-14(19-12)21-10-4-8-17-21/h1-6,8,10H,7,9H2,(H3,15,16,18,19,20) |
| InChIKey | RABUBLOMCGWCLT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |