C7H7FN4 — CID 130593616
5-fluoro-2-N-prop-2-ynylpyrimidine-2,4-diamine (PubChem CID 130593616) has the molecular formula C7H7FN4 and a molecular weight of 166.16 g/mol. Its IUPAC name is 5-fluoro-2-N-prop-2-ynylpyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-prop-2-ynylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 130593616 |
| Molecular Formula | C7H7FN4 |
| Molecular Weight | 166.16 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 5-fluoro-2-N-prop-2-ynylpyrimidine-2,4-diamine |
| SMILES | C#CCNc1ncc(F)c(N)n1 |
| InChI | InChI=1S/C7H7FN4/c1-2-3-10-7-11-4-5(8)6(9)12-7/h1,4H,3H2,(H3,9,10,11,12) |
| InChIKey | DLBYFAXVTHMKSI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|