C6H9ClN6 — CID 142726691
2-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine;hydrochloride (PubChem CID 142726691) has the molecular formula C6H9ClN6 and a molecular weight of 200.63 g/mol. Its IUPAC name is 2-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine;hydrochloride.
| Compound Name | 2-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
|---|---|
| PubChem CID | 142726691 |
| Molecular Formula | C6H9ClN6 |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine;hydrochloride |
| SMILES | C#CCNc1nc(N)nc(N)n1.Cl |
| InChI | InChI=1S/C6H8N6.ClH/c1-2-3-9-6-11-4(7)10-5(8)12-6;/h1H,3H2,(H5,7,8,9,10,11,12);1H |
| InChIKey | MBFYSQAOXUUXGR-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|