C4H8N6O — CID 175951264
deuterio-[(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol (PubChem CID 175951264) has the molecular formula C4H8N6O and a molecular weight of 157.16 g/mol. Its IUPAC name is deuterio-[(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol.
| Compound Name | deuterio-[(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol |
|---|---|
| PubChem CID | 175951264 |
| Molecular Formula | C4H8N6O |
| Molecular Weight | 157.16 g/mol |
| Exact Mass | 157.08 |
| IUPAC Name | deuterio-[(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol |
| SMILES | [2H]C(O)Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C4H8N6O/c5-2-8-3(6)10-4(9-2)7-1-11/h11H,1H2,(H5,5,6,7,8,9,10)/i1D |
| InChIKey | MBHRHUJRKGNOKX-MICDWDOJSA-N |
| XLogP | -1.60 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.16 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|