C6H9ClN6O — CID 130015511
3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propanoyl chloride (PubChem CID 130015511) has the molecular formula C6H9ClN6O and a molecular weight of 216.63 g/mol. Its IUPAC name is 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propanoyl chloride.
| Compound Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propanoyl chloride |
|---|---|
| PubChem CID | 130015511 |
| Molecular Formula | C6H9ClN6O |
| Molecular Weight | 216.63 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propanoyl chloride |
| SMILES | Nc1nc(N)nc(NCCC(=O)Cl)n1 |
| InChI | InChI=1S/C6H9ClN6O/c7-3(14)1-2-10-6-12-4(8)11-5(9)13-6/h1-2H2,(H5,8,9,10,11,12,13) |
| InChIKey | OGZKATDMDYUSMP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.63 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|