C9H14N6O2 — CID 23463406
2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]ethyl 2-methylprop-2-enoate (PubChem CID 23463406) has the molecular formula C9H14N6O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23463406 |
| Molecular Formula | C9H14N6O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C9H14N6O2/c1-5(2)6(16)17-4-3-12-9-14-7(10)13-8(11)15-9/h1,3-4H2,2H3,(H5,10,11,12,13,14,15) |
| InChIKey | DWJLFWCGQAVESL-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|