C10H14Cl6N6O — CID 88519304
[(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;1,2,3,4,5,6-hexachlorocyclohexane (PubChem CID 88519304) has the molecular formula C10H14Cl6N6O and a molecular weight of 446.98 g/mol. Its IUPAC name is [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;1,2,3,4,5,6-hexachlorocyclohexane.
| Compound Name | [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;1,2,3,4,5,6-hexachlorocyclohexane |
|---|---|
| PubChem CID | 88519304 |
| Molecular Formula | C10H14Cl6N6O |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 443.94 |
| IUPAC Name | [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;1,2,3,4,5,6-hexachlorocyclohexane |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.Nc1nc(N)nc(NCO)n1 |
| InChI | InChI=1S/C6H6Cl6.C4H8N6O/c7-1-2(8)4(10)6(12)5(11)3(1)9;5-2-8-3(6)10-4(9-2)7-1-11/h1-6H;11H,1H2,(H5,5,6,7,8,9,10) |
| InChIKey | GTNHXRFSQSXCET-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|