About [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol
[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol (PubChem CID 58571407) has the molecular formula C5H9N5O
and a molecular weight of 155.16 g/mol. Its IUPAC name is [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol.
Molecular Properties
| Compound Name | [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol |
| PubChem CID | 58571407 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol |
| SMILES | Cc1nc(N)nc(NCO)n1 |
| InChI | InChI=1S/C5H9N5O/c1-3-8-4(6)10-5(9-3)7-2-11/h11H,2H2,1H3,(H3,6,7,8,9,10) |
| InChIKey | SKCOHYHOGYXTNZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol?
The IUPAC name of [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol (CID 58571407) is [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol.
What is the SMILES notation for [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol?
The canonical SMILES for [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol is Cc1nc(N)nc(NCO)n1.
What is the InChIKey of [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol?
The InChIKey is SKCOHYHOGYXTNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O/c1-3-8-4(6)10-5(9-3)7-2-11/h11H,2H2,1H3,(H3,6,7,8,9,10).
What are the key properties of [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol?
[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol has a molecular weight of 155.16 g/mol, XLogP of -0.88, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol is sourced from PubChem (CID 58571407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).