C5H9N5O — CID 58571407
[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol (PubChem CID 58571407) has the molecular formula C5H9N5O and a molecular weight of 155.16 g/mol. Its IUPAC name is [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol.
| Compound Name | [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol |
|---|---|
| PubChem CID | 58571407 |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]methanol |
| SMILES | Cc1nc(N)nc(NCO)n1 |
| InChI | InChI=1S/C5H9N5O/c1-3-8-4(6)10-5(9-3)7-2-11/h11H,2H2,1H3,(H3,6,7,8,9,10) |
| InChIKey | SKCOHYHOGYXTNZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|