C4H9ClN6O — CID 158256516
[(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;hydrochloride (PubChem CID 158256516) has the molecular formula C4H9ClN6O and a molecular weight of 192.61 g/mol. Its IUPAC name is [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;hydrochloride.
| Compound Name | [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;hydrochloride |
|---|---|
| PubChem CID | 158256516 |
| Molecular Formula | C4H9ClN6O |
| Molecular Weight | 192.61 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;hydrochloride |
| SMILES | Cl.Nc1nc(N)nc(NCO)n1 |
| InChI | InChI=1S/C4H8N6O.ClH/c5-2-8-3(6)10-4(9-2)7-1-11;/h11H,1H2,(H5,5,6,7,8,9,10);1H |
| InChIKey | GHISCCZGCKXEDH-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.61 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|