C6H13N7 — CID 44590289
2-N-(3-aminopropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 44590289) has the molecular formula C6H13N7 and a molecular weight of 183.22 g/mol. Its IUPAC name is 2-N-(3-aminopropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(3-aminopropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 44590289 |
| Molecular Formula | C6H13N7 |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 2-N-(3-aminopropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCCNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C6H13N7/c7-2-1-3-10-6-12-4(8)11-5(9)13-6/h1-3,7H2,(H5,8,9,10,11,12,13) |
| InChIKey | BDKALSILPCJVRJ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|